C22H21F2N — CID 175391873
2,4-bis(4-fluorophenyl)-N-methyl-6-propan-2-ylaniline (PubChem CID 175391873) has the molecular formula C22H21F2N and a molecular weight of 337.41 g/mol. Its IUPAC name is 2,4-bis(4-fluorophenyl)-N-methyl-6-propan-2-ylaniline.
| Compound Name | 2,4-bis(4-fluorophenyl)-N-methyl-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 175391873 |
| Molecular Formula | C22H21F2N |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2,4-bis(4-fluorophenyl)-N-methyl-6-propan-2-ylaniline |
| SMILES | CNc1c(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)cc1C(C)C |
| InChI | InChI=1S/C22H21F2N/c1-14(2)20-12-17(15-4-8-18(23)9-5-15)13-21(22(20)25-3)16-6-10-19(24)11-7-16/h4-14,25H,1-3H3 |
| InChIKey | DMCVTTBSMQZUOE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |