C14H23N — CID 154688627
N,4-dimethyl-2,6-di(propan-2-yl)aniline (PubChem CID 154688627) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N,4-dimethyl-2,6-di(propan-2-yl)aniline.
| Compound Name | N,4-dimethyl-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 154688627 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,4-dimethyl-2,6-di(propan-2-yl)aniline |
| SMILES | CNc1c(C(C)C)cc(C)cc1C(C)C |
| InChI | InChI=1S/C14H23N/c1-9(2)12-7-11(5)8-13(10(3)4)14(12)15-6/h7-10,15H,1-6H3 |
| InChIKey | XHCFQYWOWYNXAK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |