C12H16FNO — CID 167606728
2-fluoro-N,5-dimethyl-3-propan-2-ylbenzamide (PubChem CID 167606728) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-fluoro-N,5-dimethyl-3-propan-2-ylbenzamide.
| Compound Name | 2-fluoro-N,5-dimethyl-3-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 167606728 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-fluoro-N,5-dimethyl-3-propan-2-ylbenzamide |
| SMILES | CNC(=O)c1cc(C)cc(C(C)C)c1F |
| InChI | InChI=1S/C12H16FNO/c1-7(2)9-5-8(3)6-10(11(9)13)12(15)14-4/h5-7H,1-4H3,(H,14,15) |
| InChIKey | IVZHVOZIOBHVSD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |