C9H9F2NO — CID 67627187
3,5-difluoro-N,2-dimethylbenzamide (PubChem CID 67627187) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 3,5-difluoro-N,2-dimethylbenzamide.
| Compound Name | 3,5-difluoro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 67627187 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3,5-difluoro-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(F)cc(F)c1C |
| InChI | InChI=1S/C9H9F2NO/c1-5-7(9(13)12-2)3-6(10)4-8(5)11/h3-4H,1-2H3,(H,12,13) |
| InChIKey | CYMYLPYHEHVQBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |