C19H14F3N — CID 175207275
2-fluoro-4,6-bis(4-fluorophenyl)-N-methylaniline (PubChem CID 175207275) has the molecular formula C19H14F3N and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-fluoro-4,6-bis(4-fluorophenyl)-N-methylaniline.
| Compound Name | 2-fluoro-4,6-bis(4-fluorophenyl)-N-methylaniline |
|---|---|
| PubChem CID | 175207275 |
| Molecular Formula | C19H14F3N |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-fluoro-4,6-bis(4-fluorophenyl)-N-methylaniline |
| SMILES | CNc1c(F)cc(-c2ccc(F)cc2)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14F3N/c1-23-19-17(13-4-8-16(21)9-5-13)10-14(11-18(19)22)12-2-6-15(20)7-3-12/h2-11,23H,1H3 |
| InChIKey | ICYAUHVLSBBFPJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |