C22H24FNO5P+ — CID 67735676
[(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-6-methyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium (PubChem CID 67735676) has the molecular formula C22H24FNO5P+ and a molecular weight of 432.41 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-6-methyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium.
| Compound Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-6-methyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67735676 |
| Molecular Formula | C22H24FNO5P+ |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[4-(4-fluorophenyl)-6-methyl-2-propan-2-yl-3-pyridinyl]prop-2-ynoxy]-oxophosphanium |
| SMILES | Cc1cc(-c2ccc(F)cc2)c(C#CCO[P+](=O)C[C@@H](O)CC(=O)O)c(C(C)C)n1 |
| InChI | InChI=1S/C22H23FNO5P/c1-14(2)22-19(5-4-10-29-30(28)13-18(25)12-21(26)27)20(11-15(3)24-22)16-6-8-17(23)9-7-16/h6-9,11,14,18,25H,10,12-13H2,1-3H3/p+1/t18-/m0/s1 |
| InChIKey | NXSGANRFURKDRF-SFHVURJKSA-O |
| XLogP | 4.27 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|