C40H39FO5PSi+ — CID 67853115
[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]prop-2-ynoxy]-oxophosphanium (PubChem CID 67853115) has the molecular formula C40H39FO5PSi+ and a molecular weight of 677.81 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]prop-2-ynoxy]-oxophosphanium.
| Compound Name | [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]prop-2-ynoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67853115 |
| Molecular Formula | C40H39FO5PSi+ |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]prop-2-ynoxy]-oxophosphanium |
| SMILES | Cc1cc2ccccc2c(-c2ccc(F)cc2)c1C#CCO[P+](=O)C[C@H](CC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H38FO5PSi/c1-29-26-31-14-11-12-19-37(31)39(30-21-23-32(41)24-22-30)36(29)20-13-25-45-47(44)28-33(27-38(42)43)46-48(40(2,3)4,34-15-7-5-8-16-34)35-17-9-6-10-18-35/h5-12,14-19,21-24,26,33H,25,27-28H2,1-4H3/p+1/t33-/m0/s1 |
| InChIKey | FZBSSJRXLFNJLG-XIFFEERXSA-O |
| XLogP | 8.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|