C38H52O5PSi+ — CID 67853140
[2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[2-(cyclohexylmethyl)-4,6-dimethylphenyl]propoxy]-oxophosphanium (PubChem CID 67853140) has the molecular formula C38H52O5PSi+ and a molecular weight of 647.89 g/mol. Its IUPAC name is [2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[2-(cyclohexylmethyl)-4,6-dimethylphenyl]propoxy]-oxophosphanium.
| Compound Name | [2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[2-(cyclohexylmethyl)-4,6-dimethylphenyl]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67853140 |
| Molecular Formula | C38H52O5PSi+ |
| Molecular Weight | 647.89 g/mol |
| Exact Mass | 647.33 |
| IUPAC Name | [2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[2-(cyclohexylmethyl)-4,6-dimethylphenyl]propoxy]-oxophosphanium |
| SMILES | Cc1cc(C)c(CCCO[P+](=O)CC(CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(CC2CCCCC2)c1 |
| InChI | InChI=1S/C38H51O5PSi/c1-29-24-30(2)36(32(25-29)26-31-16-9-6-10-17-31)22-15-23-42-44(41)28-33(27-37(39)40)43-45(38(3,4)5,34-18-11-7-12-19-34)35-20-13-8-14-21-35/h7-8,11-14,18-21,24-25,31,33H,6,9-10,15-17,22-23,26-28H2,1-5H3/p+1 |
| InChIKey | KNJWSJCXOCKXEA-UHFFFAOYSA-O |
| XLogP | 8.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.89 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|