C45H50FNO5PSi+ — CID 67735839
[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[(E)-3-[5-ethyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]prop-2-enoxy]-oxophosphanium (PubChem CID 67735839) has the molecular formula C45H50FNO5PSi+ and a molecular weight of 762.96 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[(E)-3-[5-ethyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]prop-2-enoxy]-oxophosphanium.
| Compound Name | [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[(E)-3-[5-ethyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]prop-2-enoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67735839 |
| Molecular Formula | C45H50FNO5PSi+ |
| Molecular Weight | 762.96 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[(E)-3-[5-ethyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]prop-2-enoxy]-oxophosphanium |
| SMILES | CCc1c(-c2ccccc2)nc(C(C)C)c(/C=C/CO[P+](=O)C[C@H](CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C45H49FNO5PSi/c1-7-39-42(33-25-27-35(46)28-26-33)40(43(32(2)3)47-44(39)34-18-11-8-12-19-34)24-17-29-51-53(50)31-36(30-41(48)49)52-54(45(4,5)6,37-20-13-9-14-21-37)38-22-15-10-16-23-38/h8-28,32,36H,7,29-31H2,1-6H3/p+1/b24-17+/t36-/m0/s1 |
| InChIKey | SYYNZSKOELUPAS-CWFFXGRGSA-O |
| XLogP | 10.43 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.96 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|