C41H51FNO5PSi — CID 67735689
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[6-tert-butyl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethenyl-methoxyphosphoryl]butanoic acid (PubChem CID 67735689) has the molecular formula C41H51FNO5PSi and a molecular weight of 715.92 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[6-tert-butyl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethenyl-methoxyphosphoryl]butanoic acid.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[6-tert-butyl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethenyl-methoxyphosphoryl]butanoic acid |
|---|---|
| PubChem CID | 67735689 |
| Molecular Formula | C41H51FNO5PSi |
| Molecular Weight | 715.92 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[6-tert-butyl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethenyl-methoxyphosphoryl]butanoic acid |
| SMILES | COP(=O)(C=Cc1c(-c2ccc(F)cc2)cc(C(C)(C)C)nc1C(C)C)C[C@H](CC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H51FNO5PSi/c1-29(2)39-35(36(27-37(43-39)40(3,4)5)30-20-22-31(42)23-21-30)24-25-49(46,47-9)28-32(26-38(44)45)48-50(41(6,7)8,33-16-12-10-13-17-33)34-18-14-11-15-19-34/h10-25,27,29,32H,26,28H2,1-9H3,(H,44,45)/t32-,49?/m0/s1 |
| InChIKey | VGXBITVOALNGJU-PGYBXFQOSA-N |
| XLogP | 9.62 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.92 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|