C44H45FNO7PSi — CID 21471499
4-[2-[6-(1,3-benzodioxol-4-yl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-methoxyphosphoryl]-3-[tert-butyl(diphenyl)silyl]oxybutanoic acid (PubChem CID 21471499) has the molecular formula C44H45FNO7PSi and a molecular weight of 777.90 g/mol. Its IUPAC name is 4-[2-[6-(1,3-benzodioxol-4-yl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-methoxyphosphoryl]-3-[tert-butyl(diphenyl)silyl]oxybutanoic acid.
| Compound Name | 4-[2-[6-(1,3-benzodioxol-4-yl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-methoxyphosphoryl]-3-[tert-butyl(diphenyl)silyl]oxybutanoic acid |
|---|---|
| PubChem CID | 21471499 |
| Molecular Formula | C44H45FNO7PSi |
| Molecular Weight | 777.90 g/mol |
| Exact Mass | 777.27 |
| IUPAC Name | 4-[2-[6-(1,3-benzodioxol-4-yl)-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]ethynyl-methoxyphosphoryl]-3-[tert-butyl(diphenyl)silyl]oxybutanoic acid |
| SMILES | COP(=O)(C#Cc1c(-c2ccc(F)cc2)cc(-c2cccc3c2OCO3)nc1C(C)C)CC(CC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H45FNO7PSi/c1-30(2)42-36(38(31-20-22-32(45)23-21-31)27-39(46-42)37-18-13-19-40-43(37)52-29-51-40)24-25-54(49,50-6)28-33(26-41(47)48)53-55(44(3,4)5,34-14-9-7-10-15-34)35-16-11-8-12-17-35/h7-23,27,30,33H,26,28-29H2,1-6H3,(H,47,48) |
| InChIKey | KMCFOIXIBXKCCZ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.90 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|