C42H42FNO4Si — CID 132567614
methyl (Z,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-5-yl]-5-oxohept-6-enoate (PubChem CID 132567614) has the molecular formula C42H42FNO4Si and a molecular weight of 671.89 g/mol. Its IUPAC name is methyl (Z,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-5-yl]-5-oxohept-6-enoate.
| Compound Name | methyl (Z,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-5-yl]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 132567614 |
| Molecular Formula | C42H42FNO4Si |
| Molecular Weight | 671.89 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | methyl (Z,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-5-yl]-5-oxohept-6-enoate |
| SMILES | COC(=O)C[C@@H](CC(=O)/C=C\c1cccc2nc(C3CC3)cc(-c3ccc(F)cc3)c12)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H42FNO4Si/c1-42(2,3)49(35-13-7-5-8-14-35,36-15-9-6-10-16-36)48-34(27-40(46)47-4)26-33(45)25-22-31-12-11-17-38-41(31)37(28-39(44-38)30-18-19-30)29-20-23-32(43)24-21-29/h5-17,20-25,28,30,34H,18-19,26-27H2,1-4H3/b25-22-/t34-/m1/s1 |
| InChIKey | VPPWTWVOUQZBTC-VYIFUBFESA-N |
| XLogP | 8.40 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.89 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|