C29H42FN3O6SSi — CID 77293252
methyl 3-[tert-butyl(dimethyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-(methylsulfonylmethylamino)-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate (PubChem CID 77293252) has the molecular formula C29H42FN3O6SSi and a molecular weight of 607.82 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-(methylsulfonylmethylamino)-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-(methylsulfonylmethylamino)-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 77293252 |
| Molecular Formula | C29H42FN3O6SSi |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-(methylsulfonylmethylamino)-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate |
| SMILES | COC(=O)CC(CC(=O)C=Cc1c(-c2ccc(F)cc2)nc(NCS(C)(=O)=O)nc1C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H42FN3O6SSi/c1-19(2)26-24(15-14-22(34)16-23(17-25(35)38-6)39-41(8,9)29(3,4)5)27(20-10-12-21(30)13-11-20)33-28(32-26)31-18-40(7,36)37/h10-15,19,23H,16-18H2,1-9H3,(H,31,32,33) |
| InChIKey | WJVMBLBRTMYCFL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|