C27H36FN3O6S — CID 144775336
tert-butyl (E)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dioxohept-6-enoate;methane (PubChem CID 144775336) has the molecular formula C27H36FN3O6S and a molecular weight of 549.67 g/mol. Its IUPAC name is tert-butyl (E)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dioxohept-6-enoate;methane.
| Compound Name | tert-butyl (E)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dioxohept-6-enoate;methane |
|---|---|
| PubChem CID | 144775336 |
| Molecular Formula | C27H36FN3O6S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | tert-butyl (E)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dioxohept-6-enoate;methane |
| SMILES | C.CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/C(=O)CC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32FN3O6S.CH4/c1-16(2)23-21(13-12-19(31)14-20(32)15-22(33)36-26(3,4)5)24(17-8-10-18(27)11-9-17)29-25(28-23)30(6)37(7,34)35;/h8-13,16H,14-15H2,1-7H3;1H4/b13-12+; |
| InChIKey | PZKSQGIXSAHUOO-UEIGIMKUSA-N |
| XLogP | 4.71 |
| TPSA | 123.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|