C40H48FN3O6SSi — CID 24796204
ethyl (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate (PubChem CID 24796204) has the molecular formula C40H48FN3O6SSi and a molecular weight of 745.99 g/mol. Its IUPAC name is ethyl (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate.
| Compound Name | ethyl (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 24796204 |
| Molecular Formula | C40H48FN3O6SSi |
| Molecular Weight | 745.99 g/mol |
| Exact Mass | 745.30 |
| IUPAC Name | ethyl (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-5-oxohept-6-enoate |
| SMILES | CCOC(=O)C[C@@H](CC(=O)/C=C/c1c(-c2ccc(F)cc2)nc(N(C)S(C)(=O)=O)nc1C(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H48FN3O6SSi/c1-9-49-36(46)27-32(50-52(40(4,5)6,33-16-12-10-13-17-33)34-18-14-11-15-19-34)26-31(45)24-25-35-37(28(2)3)42-39(44(7)51(8,47)48)43-38(35)29-20-22-30(41)23-21-29/h10-25,28,32H,9,26-27H2,1-8H3/b25-24+/t32-/m1/s1 |
| InChIKey | ARTWNFYIRDYCAY-RUEYHTOUSA-N |
| XLogP | 6.67 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.99 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|