C25H25FN2O5P+ — CID 22988341
(3-carboxy-2-hydroxypropyl)-[3-[4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrazol-3-yl]prop-2-ynoxy]-oxophosphanium (PubChem CID 22988341) has the molecular formula C25H25FN2O5P+ and a molecular weight of 483.46 g/mol. Its IUPAC name is (3-carboxy-2-hydroxypropyl)-[3-[4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrazol-3-yl]prop-2-ynoxy]-oxophosphanium.
| Compound Name | (3-carboxy-2-hydroxypropyl)-[3-[4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrazol-3-yl]prop-2-ynoxy]-oxophosphanium |
|---|---|
| PubChem CID | 22988341 |
| Molecular Formula | C25H25FN2O5P+ |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (3-carboxy-2-hydroxypropyl)-[3-[4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrazol-3-yl]prop-2-ynoxy]-oxophosphanium |
| SMILES | CC(C)n1nc(-c2ccccc2)c(-c2ccc(F)cc2)c1C#CCO[P+](=O)CC(O)CC(=O)O |
| InChI | InChI=1S/C25H24FN2O5P/c1-17(2)28-22(9-6-14-33-34(32)16-21(29)15-23(30)31)24(18-10-12-20(26)13-11-18)25(27-28)19-7-4-3-5-8-19/h3-5,7-8,10-13,17,21,29H,14-16H2,1-2H3/p+1 |
| InChIKey | OMVMANTXSRTYMY-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|