C23H27FNO5P — CID 15177246
(3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid (PubChem CID 15177246) has the molecular formula C23H27FNO5P and a molecular weight of 447.44 g/mol. Its IUPAC name is (3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid.
| Compound Name | (3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 15177246 |
| Molecular Formula | C23H27FNO5P |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid |
| SMILES | CC(C)c1c(C#CP(=O)(O)C[C@@H](O)CC(=O)O)c(-c2ccc(F)cc2)c2n1CCCC2 |
| InChI | InChI=1S/C23H27FNO5P/c1-15(2)23-19(10-12-31(29,30)14-18(26)13-21(27)28)22(16-6-8-17(24)9-7-16)20-5-3-4-11-25(20)23/h6-9,15,18,26H,3-5,11,13-14H2,1-2H3,(H,27,28)(H,29,30)/t18-/m0/s1 |
| InChIKey | OXWGQULTVXWEBE-SFHVURJKSA-N |
| XLogP | 4.17 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|