C19H21Cl3FNO — CID 19892485
2,2,2-trichloro-1-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethanol (PubChem CID 19892485) has the molecular formula C19H21Cl3FNO and a molecular weight of 404.74 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethanol.
| Compound Name | 2,2,2-trichloro-1-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethanol |
|---|---|
| PubChem CID | 19892485 |
| Molecular Formula | C19H21Cl3FNO |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2,2,2-trichloro-1-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]ethanol |
| SMILES | CC(C)c1c(C(O)C(Cl)(Cl)Cl)c(-c2ccc(F)cc2)c2n1CCCC2 |
| InChI | InChI=1S/C19H21Cl3FNO/c1-11(2)17-16(18(25)19(20,21)22)15(12-6-8-13(23)9-7-12)14-5-3-4-10-24(14)17/h6-9,11,18,25H,3-5,10H2,1-2H3 |
| InChIKey | RCMQLJCDPMUMNK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|