2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid

C22H21NO2 — CID 14855731

IUPAC2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid
SMILESCC(C(=O)O)c1c(-c2ccccc2)c(-c2ccccc2)c2n1CCC2
InChIInChI=1S/C22H21NO2/c1-15(22(24)25)21-20(17-11-6-3-7-12-17)19(16-9-4-2-5-10-16)18-13-8-14-23(18)21/h2-7,9-12,15H,8,13-14H2,1H3,(H,24,25)
InChIKeyXVRNWKDEBIULBH-UHFFFAOYSA-N
MW331.42 g/mol
LogP4.96
Rot. Bonds4

About 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid

2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid (PubChem CID 14855731) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid.

Molecular Properties

Compound Name2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid
PubChem CID14855731
Molecular FormulaC22H21NO2
Molecular Weight331.42 g/mol
Exact Mass331.16
IUPAC Name2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid
SMILESCC(C(=O)O)c1c(-c2ccccc2)c(-c2ccccc2)c2n1CCC2
InChIInChI=1S/C22H21NO2/c1-15(22(24)25)21-20(17-11-6-3-7-12-17)19(16-9-4-2-5-10-16)18-13-8-14-23(18)21/h2-7,9-12,15H,8,13-14H2,1H3,(H,24,25)
InChIKeyXVRNWKDEBIULBH-UHFFFAOYSA-N
XLogP4.96
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.42
LogP ≤ 54.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid?
The IUPAC name of 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid (CID 14855731) is 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid.
What is the SMILES notation for 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid?
The canonical SMILES for 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid is CC(C(=O)O)c1c(-c2ccccc2)c(-c2ccccc2)c2n1CCC2.
What is the InChIKey of 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid?
The InChIKey is XVRNWKDEBIULBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c1-15(22(24)25)21-20(17-11-6-3-7-12-17)19(16-9-4-2-5-10-16)18-13-8-14-23(18)21/h2-7,9-12,15H,8,13-14H2,1H3,(H,24,25).
What are the key properties of 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid?
2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid has a molecular weight of 331.42 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid is sourced from PubChem (CID 14855731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).