C22H21NO2 — CID 14855731
2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid (PubChem CID 14855731) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid.
| Compound Name | 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 14855731 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-(1,2-diphenyl-6,7-dihydro-5H-pyrrolizin-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1c(-c2ccccc2)c(-c2ccccc2)c2n1CCC2 |
| InChI | InChI=1S/C22H21NO2/c1-15(22(24)25)21-20(17-11-6-3-7-12-17)19(16-9-4-2-5-10-16)18-13-8-14-23(18)21/h2-7,9-12,15H,8,13-14H2,1H3,(H,24,25) |
| InChIKey | XVRNWKDEBIULBH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |