C29H25NO2 — CID 10835875
(E)-3-[2-(4-benzylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid (PubChem CID 10835875) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-3-[2-(4-benzylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(4-benzylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10835875 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (E)-3-[2-(4-benzylphenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(-c2ccc(Cc3ccccc3)cc2)c(-c2ccccc2)c2n1CCC2 |
| InChI | InChI=1S/C29H25NO2/c31-27(32)18-17-26-29(24-15-13-22(14-16-24)20-21-8-3-1-4-9-21)28(23-10-5-2-6-11-23)25-12-7-19-30(25)26/h1-6,8-11,13-18H,7,12,19-20H2,(H,31,32)/b18-17+ |
| InChIKey | WOBHTTGEXKWXCG-ISLYRVAYSA-N |
| XLogP | 6.46 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|