C11H11N3O2 — CID 116984372
(E)-3-(1-cyano-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)prop-2-enoic acid (PubChem CID 116984372) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is (E)-3-(1-cyano-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1-cyano-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 116984372 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (E)-3-(1-cyano-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)prop-2-enoic acid |
| SMILES | N#Cc1nc(/C=C/C(=O)O)n2c1CCCC2 |
| InChI | InChI=1S/C11H11N3O2/c12-7-8-9-3-1-2-6-14(9)10(13-8)4-5-11(15)16/h4-5H,1-3,6H2,(H,15,16)/b5-4+ |
| InChIKey | PIYFVXMDAXVRPB-SNAWJCMRSA-N |
| XLogP | 1.19 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|