C9H10ClN3 — CID 116984332
3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonitrile (PubChem CID 116984332) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonitrile.
| Compound Name | 3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonitrile |
|---|---|
| PubChem CID | 116984332 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonitrile |
| SMILES | N#Cc1nc(CCl)n2c1CCCC2 |
| InChI | InChI=1S/C9H10ClN3/c10-5-9-12-7(6-11)8-3-1-2-4-13(8)9/h1-5H2 |
| InChIKey | ZVHNLHDWNYJRKP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|