C9H13ClN2O — CID 116984469
[3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanol (PubChem CID 116984469) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is [3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanol.
| Compound Name | [3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanol |
|---|---|
| PubChem CID | 116984469 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | [3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanol |
| SMILES | OCc1nc(CCl)n2c1CCCC2 |
| InChI | InChI=1S/C9H13ClN2O/c10-5-9-11-7(6-13)8-3-1-2-4-12(8)9/h13H,1-6H2 |
| InChIKey | HJKZRDLHSOUKHJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|