C8H14N4O — CID 116984559
(3-hydrazinyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)methanol (PubChem CID 116984559) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is (3-hydrazinyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)methanol.
| Compound Name | (3-hydrazinyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)methanol |
|---|---|
| PubChem CID | 116984559 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (3-hydrazinyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)methanol |
| SMILES | NNc1nc(CO)c2n1CCCC2 |
| InChI | InChI=1S/C8H14N4O/c9-11-8-10-6(5-13)7-3-1-2-4-12(7)8/h13H,1-5,9H2,(H,10,11) |
| InChIKey | ZHFFRHMHVCZEHK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|