C8H11BrN2S — CID 117247227
(1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)methanethiol (PubChem CID 117247227) has the molecular formula C8H11BrN2S and a molecular weight of 247.16 g/mol. Its IUPAC name is (1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)methanethiol.
| Compound Name | (1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)methanethiol |
|---|---|
| PubChem CID | 117247227 |
| Molecular Formula | C8H11BrN2S |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | (1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)methanethiol |
| SMILES | SCc1nc(Br)c2n1CCCC2 |
| InChI | InChI=1S/C8H11BrN2S/c9-8-6-3-1-2-4-11(6)7(5-12)10-8/h12H,1-5H2 |
| InChIKey | CPSDSRGSSFKJQU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|