About 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine
2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 10356283) has the molecular formula C7H8Br2N2
and a molecular weight of 279.96 g/mol. Its IUPAC name is 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
Analyze 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
The IUPAC name of 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (CID 10356283) is 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
The canonical SMILES for 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine is Brc1nc2n(c1Br)CCCC2.
What is the InChIKey of 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
The InChIKey is UVSGSHSBMKNXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Br2N2/c8-6-7(9)11-4-2-1-3-5(11)10-6/h1-4H2.
What are the key properties of 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine?
2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine has a molecular weight of 279.96 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 10356283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).