C11H8Cl4N2 — CID 165351379
6,7,8,9-tetrachloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole (PubChem CID 165351379) has the molecular formula C11H8Cl4N2 and a molecular weight of 310.01 g/mol. Its IUPAC name is 6,7,8,9-tetrachloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole.
| Compound Name | 6,7,8,9-tetrachloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 165351379 |
| Molecular Formula | C11H8Cl4N2 |
| Molecular Weight | 310.01 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 6,7,8,9-tetrachloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole |
| SMILES | Clc1c(Cl)c(Cl)c2c(nc3n2CCCC3)c1Cl |
| InChI | InChI=1S/C11H8Cl4N2/c12-6-7(13)9(15)11-10(8(6)14)16-5-3-1-2-4-17(5)11/h1-4H2 |
| InChIKey | VJBAOJJDYKZEQK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|