About 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 123716974) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 123716974 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | Cc1c(Cl)nc2n1CCC2 |
| InChI | InChI=1S/C7H9ClN2/c1-5-7(8)9-6-3-2-4-10(5)6/h2-4H2,1H3 |
| InChIKey | AMMSSYZATFPDJD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 123716974) is 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is Cc1c(Cl)nc2n1CCC2.
What is the InChIKey of 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is AMMSSYZATFPDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2/c1-5-7(8)9-6-3-2-4-10(5)6/h2-4H2,1H3.
What are the key properties of 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 156.62 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 123716974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).