About 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole
6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (PubChem CID 695586) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| PubChem CID | 695586 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| SMILES | Cc1cc2nc3n(c2cc1C)CCC3 |
| InChI | InChI=1S/C12H14N2/c1-8-6-10-11(7-9(8)2)14-5-3-4-12(14)13-10/h6-7H,3-5H2,1-2H3 |
| InChIKey | OEQHHLTWJGGPFT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The IUPAC name of 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (CID 695586) is 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
What is the SMILES notation for 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The canonical SMILES for 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole is Cc1cc2nc3n(c2cc1C)CCC3.
What is the InChIKey of 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The InChIKey is OEQHHLTWJGGPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-8-6-10-11(7-9(8)2)14-5-3-4-12(14)13-10/h6-7H,3-5H2,1-2H3.
What are the key properties of 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole has a molecular weight of 186.26 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole is sourced from PubChem (CID 695586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).