C11H10N4O4 — CID 154700687
7,8-dinitro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole (PubChem CID 154700687) has the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. Its IUPAC name is 7,8-dinitro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole.
| Compound Name | 7,8-dinitro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 154700687 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 7,8-dinitro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole |
| SMILES | O=[N+]([O-])c1cc2nc3n(c2cc1[N+](=O)[O-])CCCC3 |
| InChI | InChI=1S/C11H10N4O4/c16-14(17)9-5-7-8(6-10(9)15(18)19)13-4-2-1-3-11(13)12-7/h5-6H,1-4H2 |
| InChIKey | TZEZBUVLAWDJMI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|