About 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine
6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine (PubChem CID 175752504) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine.
Molecular Properties
| Compound Name | 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine |
| PubChem CID | 175752504 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine |
| SMILES | Cc1cc2nc3n(c2cc1N)CCC3 |
| InChI | InChI=1S/C11H13N3/c1-7-5-9-10(6-8(7)12)14-4-2-3-11(14)13-9/h5-6H,2-4,12H2,1H3 |
| InChIKey | LZUBIMWLRBQWHT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine?
The IUPAC name of 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine (CID 175752504) is 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine.
What is the SMILES notation for 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine?
The canonical SMILES for 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine is Cc1cc2nc3n(c2cc1N)CCC3.
What is the InChIKey of 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine?
The InChIKey is LZUBIMWLRBQWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-7-5-9-10(6-8(7)12)14-4-2-3-11(14)13-9/h5-6H,2-4,12H2,1H3.
What are the key properties of 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine?
6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine has a molecular weight of 187.25 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine is sourced from PubChem (CID 175752504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).