C11H13N3 — CID 175752504
6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine (PubChem CID 175752504) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine.
| Compound Name | 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine |
|---|---|
| PubChem CID | 175752504 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 6-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-7-amine |
| SMILES | Cc1cc2nc3n(c2cc1N)CCC3 |
| InChI | InChI=1S/C11H13N3/c1-7-5-9-10(6-8(7)12)14-4-2-3-11(14)13-9/h5-6H,2-4,12H2,1H3 |
| InChIKey | LZUBIMWLRBQWHT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|