C10H9N3O2 — CID 102045736
7-nitro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (PubChem CID 102045736) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 7-nitro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
| Compound Name | 7-nitro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 102045736 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 7-nitro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc3n(c2c1)CCC3 |
| InChI | InChI=1S/C10H9N3O2/c14-13(15)7-3-4-8-9(6-7)12-5-1-2-10(12)11-8/h3-4,6H,1-2,5H2 |
| InChIKey | WIYXSPITFVMQBI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|