C16H19N5 — CID 46862205
4,10,14,20-tetrazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,9,11,19-pentaen-2-amine (PubChem CID 46862205) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4,10,14,20-tetrazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,9,11,19-pentaen-2-amine.
| Compound Name | 4,10,14,20-tetrazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,9,11,19-pentaen-2-amine |
|---|---|
| PubChem CID | 46862205 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4,10,14,20-tetrazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,9,11,19-pentaen-2-amine |
| SMILES | Nc1c2nc3n(c2cc2nc4n(c12)CCCC4)CCCC3 |
| InChI | InChI=1S/C16H19N5/c17-14-15-11(20-7-3-1-6-13(20)19-15)9-10-16(14)21-8-4-2-5-12(21)18-10/h9H,1-8,17H2 |
| InChIKey | SXGAGGXWFPDJBO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|