About 6,7-dinitroquinoxaline
6,7-dinitroquinoxaline (PubChem CID 2724608) has the molecular formula C8H4N4O4
and a molecular weight of 220.14 g/mol. Its IUPAC name is 6,7-dinitroquinoxaline.
Molecular Properties
| Compound Name | 6,7-dinitroquinoxaline |
| PubChem CID | 2724608 |
| Molecular Formula | C8H4N4O4 |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 6,7-dinitroquinoxaline |
| SMILES | O=[N+]([O-])c1cc2nccnc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4N4O4/c13-11(14)7-3-5-6(10-2-1-9-5)4-8(7)12(15)16/h1-4H |
| InChIKey | MRCFKNAXRGITFV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dinitroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dinitroquinoxaline?
The IUPAC name of 6,7-dinitroquinoxaline (CID 2724608) is 6,7-dinitroquinoxaline.
What is the SMILES notation for 6,7-dinitroquinoxaline?
The canonical SMILES for 6,7-dinitroquinoxaline is O=[N+]([O-])c1cc2nccnc2cc1[N+](=O)[O-].
What is the InChIKey of 6,7-dinitroquinoxaline?
The InChIKey is MRCFKNAXRGITFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4O4/c13-11(14)7-3-5-6(10-2-1-9-5)4-8(7)12(15)16/h1-4H.
What are the key properties of 6,7-dinitroquinoxaline?
6,7-dinitroquinoxaline has a molecular weight of 220.14 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dinitroquinoxaline is sourced from PubChem (CID 2724608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).