About disodium;6,7-dinitroquinoxaline-2,3-diolate
disodium;6,7-dinitroquinoxaline-2,3-diolate (PubChem CID 172966637) has the molecular formula C8H2N4Na2O6
and a molecular weight of 296.11 g/mol. Its IUPAC name is disodium;6,7-dinitroquinoxaline-2,3-diolate.
Molecular Properties
| Compound Name | disodium;6,7-dinitroquinoxaline-2,3-diolate |
| PubChem CID | 172966637 |
| Molecular Formula | C8H2N4Na2O6 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | disodium;6,7-dinitroquinoxaline-2,3-diolate |
| SMILES | O=[N+]([O-])c1cc2nc([O-])c([O-])nc2cc1[N+](=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H4N4O6.2Na/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7;;/h1-2H,(H,9,13)(H,10,14);;/q;2*+1/p-2 |
| InChIKey | GPSBSOYURFUVKJ-UHFFFAOYSA-L |
| XLogP | -6.40 |
| TPSA | 158.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | -6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disodium;6,7-dinitroquinoxaline-2,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;6,7-dinitroquinoxaline-2,3-diolate?
The IUPAC name of disodium;6,7-dinitroquinoxaline-2,3-diolate (CID 172966637) is disodium;6,7-dinitroquinoxaline-2,3-diolate.
What is the SMILES notation for disodium;6,7-dinitroquinoxaline-2,3-diolate?
The canonical SMILES for disodium;6,7-dinitroquinoxaline-2,3-diolate is O=[N+]([O-])c1cc2nc([O-])c([O-])nc2cc1[N+](=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;6,7-dinitroquinoxaline-2,3-diolate?
The InChIKey is GPSBSOYURFUVKJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H4N4O6.2Na/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7;;/h1-2H,(H,9,13)(H,10,14);;/q;2*+1/p-2.
What are the key properties of disodium;6,7-dinitroquinoxaline-2,3-diolate?
disodium;6,7-dinitroquinoxaline-2,3-diolate has a molecular weight of 296.11 g/mol, XLogP of -6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;6,7-dinitroquinoxaline-2,3-diolate is sourced from PubChem (CID 172966637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).