C8H2N4Na2O6 — CID 172966637
disodium;6,7-dinitroquinoxaline-2,3-diolate (PubChem CID 172966637) has the molecular formula C8H2N4Na2O6 and a molecular weight of 296.11 g/mol. Its IUPAC name is disodium;6,7-dinitroquinoxaline-2,3-diolate.
| Compound Name | disodium;6,7-dinitroquinoxaline-2,3-diolate |
|---|---|
| PubChem CID | 172966637 |
| Molecular Formula | C8H2N4Na2O6 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | disodium;6,7-dinitroquinoxaline-2,3-diolate |
| SMILES | O=[N+]([O-])c1cc2nc([O-])c([O-])nc2cc1[N+](=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H4N4O6.2Na/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7;;/h1-2H,(H,9,13)(H,10,14);;/q;2*+1/p-2 |
| InChIKey | GPSBSOYURFUVKJ-UHFFFAOYSA-L |
| XLogP | -6.40 |
| TPSA | 158.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | -6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|