C7H5N3O2S — CID 19691924
6-methyl-5-nitro-2,1,3-benzothiadiazole (PubChem CID 19691924) has the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. Its IUPAC name is 6-methyl-5-nitro-2,1,3-benzothiadiazole.
| Compound Name | 6-methyl-5-nitro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 19691924 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 6-methyl-5-nitro-2,1,3-benzothiadiazole |
| SMILES | Cc1cc2nsnc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O2S/c1-4-2-5-6(9-13-8-5)3-7(4)10(11)12/h2-3H,1H3 |
| InChIKey | JYFRADGAHMOOOH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|