About 1-methyl-2-nitro-4,5-dinitrosobenzene
1-methyl-2-nitro-4,5-dinitrosobenzene (PubChem CID 3321739) has the molecular formula C7H5N3O4
and a molecular weight of 195.13 g/mol. Its IUPAC name is 1-methyl-2-nitro-4,5-dinitrosobenzene.
Molecular Properties
| Compound Name | 1-methyl-2-nitro-4,5-dinitrosobenzene |
| PubChem CID | 3321739 |
| Molecular Formula | C7H5N3O4 |
| Molecular Weight | 195.13 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 1-methyl-2-nitro-4,5-dinitrosobenzene |
| SMILES | Cc1cc(N=O)c(N=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O4/c1-4-2-5(8-11)6(9-12)3-7(4)10(13)14/h2-3H,1H3 |
| InChIKey | DPTSAQCQZOCVOU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.13 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-nitro-4,5-dinitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-nitro-4,5-dinitrosobenzene?
The IUPAC name of 1-methyl-2-nitro-4,5-dinitrosobenzene (CID 3321739) is 1-methyl-2-nitro-4,5-dinitrosobenzene.
What is the SMILES notation for 1-methyl-2-nitro-4,5-dinitrosobenzene?
The canonical SMILES for 1-methyl-2-nitro-4,5-dinitrosobenzene is Cc1cc(N=O)c(N=O)cc1[N+](=O)[O-].
What is the InChIKey of 1-methyl-2-nitro-4,5-dinitrosobenzene?
The InChIKey is DPTSAQCQZOCVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O4/c1-4-2-5(8-11)6(9-12)3-7(4)10(13)14/h2-3H,1H3.
What are the key properties of 1-methyl-2-nitro-4,5-dinitrosobenzene?
1-methyl-2-nitro-4,5-dinitrosobenzene has a molecular weight of 195.13 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-nitro-4,5-dinitrosobenzene is sourced from PubChem (CID 3321739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).