About (5-methyl-2,4-dinitrophenyl) thiohypochlorite
(5-methyl-2,4-dinitrophenyl) thiohypochlorite (PubChem CID 169084895) has the molecular formula C7H5ClN2O4S
and a molecular weight of 248.65 g/mol. Its IUPAC name is (5-methyl-2,4-dinitrophenyl) thiohypochlorite.
Molecular Properties
| Compound Name | (5-methyl-2,4-dinitrophenyl) thiohypochlorite |
| PubChem CID | 169084895 |
| Molecular Formula | C7H5ClN2O4S |
| Molecular Weight | 248.65 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | (5-methyl-2,4-dinitrophenyl) thiohypochlorite |
| SMILES | Cc1cc(SCl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5ClN2O4S/c1-4-2-7(15-8)6(10(13)14)3-5(4)9(11)12/h2-3H,1H3 |
| InChIKey | NCQYRLGPPUDYLT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2,4-dinitrophenyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2,4-dinitrophenyl) thiohypochlorite?
The IUPAC name of (5-methyl-2,4-dinitrophenyl) thiohypochlorite (CID 169084895) is (5-methyl-2,4-dinitrophenyl) thiohypochlorite.
What is the SMILES notation for (5-methyl-2,4-dinitrophenyl) thiohypochlorite?
The canonical SMILES for (5-methyl-2,4-dinitrophenyl) thiohypochlorite is Cc1cc(SCl)c([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (5-methyl-2,4-dinitrophenyl) thiohypochlorite?
The InChIKey is NCQYRLGPPUDYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O4S/c1-4-2-7(15-8)6(10(13)14)3-5(4)9(11)12/h2-3H,1H3.
What are the key properties of (5-methyl-2,4-dinitrophenyl) thiohypochlorite?
(5-methyl-2,4-dinitrophenyl) thiohypochlorite has a molecular weight of 248.65 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2,4-dinitrophenyl) thiohypochlorite is sourced from PubChem (CID 169084895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).