C11H15N5O8 — CID 158340569
methane;N-(5-methyl-2,4-dinitrophenyl)-N-(2-nitropropyl)nitramide (PubChem CID 158340569) has the molecular formula C11H15N5O8 and a molecular weight of 345.27 g/mol. Its IUPAC name is methane;N-(5-methyl-2,4-dinitrophenyl)-N-(2-nitropropyl)nitramide.
| Compound Name | methane;N-(5-methyl-2,4-dinitrophenyl)-N-(2-nitropropyl)nitramide |
|---|---|
| PubChem CID | 158340569 |
| Molecular Formula | C11H15N5O8 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | methane;N-(5-methyl-2,4-dinitrophenyl)-N-(2-nitropropyl)nitramide |
| SMILES | C.Cc1cc(N(CC(C)[N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O8.CH4/c1-6-3-9(10(14(20)21)4-8(6)13(18)19)11(15(22)23)5-7(2)12(16)17;/h3-4,7H,5H2,1-2H3;1H4 |
| InChIKey | GRCNYAKKQPEOPC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|