About 1,1'-biphenyl;5-nitroquinoxaline
1,1'-biphenyl;5-nitroquinoxaline (PubChem CID 174497247) has the molecular formula C20H15N3O2
and a molecular weight of 329.36 g/mol. Its IUPAC name is 1,1'-biphenyl;5-nitroquinoxaline.
Molecular Properties
| Compound Name | 1,1'-biphenyl;5-nitroquinoxaline |
| PubChem CID | 174497247 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1,1'-biphenyl;5-nitroquinoxaline |
| SMILES | O=[N+]([O-])c1cccc2nccnc12.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H5N3O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;12-11(13)7-3-1-2-6-8(7)10-5-4-9-6/h1-10H;1-5H |
| InChIKey | KBVJUDGXVIKMOR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;5-nitroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;5-nitroquinoxaline?
The IUPAC name of 1,1'-biphenyl;5-nitroquinoxaline (CID 174497247) is 1,1'-biphenyl;5-nitroquinoxaline.
What is the SMILES notation for 1,1'-biphenyl;5-nitroquinoxaline?
The canonical SMILES for 1,1'-biphenyl;5-nitroquinoxaline is O=[N+]([O-])c1cccc2nccnc12.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;5-nitroquinoxaline?
The InChIKey is KBVJUDGXVIKMOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C8H5N3O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;12-11(13)7-3-1-2-6-8(7)10-5-4-9-6/h1-10H;1-5H.
What are the key properties of 1,1'-biphenyl;5-nitroquinoxaline?
1,1'-biphenyl;5-nitroquinoxaline has a molecular weight of 329.36 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;5-nitroquinoxaline is sourced from PubChem (CID 174497247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).