C6H3ClN3O3- — CID 21284690
4-nitro-1,2,3-benzoxadiazole chloride (PubChem CID 21284690) has the molecular formula C6H3ClN3O3- and a molecular weight of 200.56 g/mol. Its IUPAC name is 4-nitro-1,2,3-benzoxadiazole chloride.
| Compound Name | 4-nitro-1,2,3-benzoxadiazole chloride |
|---|---|
| PubChem CID | 21284690 |
| Molecular Formula | C6H3ClN3O3- |
| Molecular Weight | 200.56 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 4-nitro-1,2,3-benzoxadiazole chloride |
| SMILES | O=[N+]([O-])c1cccc2onnc12.[Cl-] |
| InChI | InChI=1S/C6H3N3O3.ClH/c10-9(11)4-2-1-3-5-6(4)7-8-12-5;/h1-3H;1H/p-1 |
| InChIKey | APBPUKOCGHNHKA-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.56 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|