C8H6N2O4 — CID 131842931
3-methyl-4-nitro-1,3-benzoxazol-2-one (PubChem CID 131842931) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 3-methyl-4-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-4-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 131842931 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3-methyl-4-nitro-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C8H6N2O4/c1-9-7-5(10(12)13)3-2-4-6(7)14-8(9)11/h2-4H,1H3 |
| InChIKey | KLCKEQRAXKVKPP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|