C10H9N3O4 — CID 177185302
1,4-dimethyl-5-nitroquinoxaline-2,3-dione (PubChem CID 177185302) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 1,4-dimethyl-5-nitroquinoxaline-2,3-dione.
| Compound Name | 1,4-dimethyl-5-nitroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 177185302 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1,4-dimethyl-5-nitroquinoxaline-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C)c2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C10H9N3O4/c1-11-6-4-3-5-7(13(16)17)8(6)12(2)10(15)9(11)14/h3-5H,1-2H3 |
| InChIKey | GVIYBXRLWZGNHC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|