C11H8N4O7 — CID 102109905
1,8-dimethyl-3,5,7-trinitroquinolin-2-one (PubChem CID 102109905) has the molecular formula C11H8N4O7 and a molecular weight of 308.21 g/mol. Its IUPAC name is 1,8-dimethyl-3,5,7-trinitroquinolin-2-one.
| Compound Name | 1,8-dimethyl-3,5,7-trinitroquinolin-2-one |
|---|---|
| PubChem CID | 102109905 |
| Molecular Formula | C11H8N4O7 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1,8-dimethyl-3,5,7-trinitroquinolin-2-one |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c2cc([N+](=O)[O-])c(=O)n(C)c12 |
| InChI | InChI=1S/C11H8N4O7/c1-5-7(13(17)18)4-8(14(19)20)6-3-9(15(21)22)11(16)12(2)10(5)6/h3-4H,1-2H3 |
| InChIKey | HLDDRGOIDFMGFJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 151.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|