About ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione
ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 170584721) has the molecular formula C7H11N3O4
and a molecular weight of 201.18 g/mol. Its IUPAC name is ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione |
| PubChem CID | 170584721 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | CC.Cn1c(=O)[nH]cc([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C5H5N3O4.C2H6/c1-7-4(9)3(8(11)12)2-6-5(7)10;1-2/h2H,1H3,(H,6,10);1-2H3 |
| InChIKey | YKVHLPBZYZRHOV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione?
The IUPAC name of ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione (CID 170584721) is ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione.
What is the SMILES notation for ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione?
The canonical SMILES for ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione is CC.Cn1c(=O)[nH]cc([N+](=O)[O-])c1=O.
What is the InChIKey of ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione?
The InChIKey is YKVHLPBZYZRHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O4.C2H6/c1-7-4(9)3(8(11)12)2-6-5(7)10;1-2/h2H,1H3,(H,6,10);1-2H3.
What are the key properties of ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione?
ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione has a molecular weight of 201.18 g/mol, XLogP of 0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5-nitro-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 170584721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).