C23H23N5O5 — CID 58486086
3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-4-nitro-1,3-benzoxazol-2-one (PubChem CID 58486086) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-4-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-4-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 58486086 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-4-nitro-1,3-benzoxazol-2-one |
| SMILES | CN(C)CCCOc1cnc(-c2cccc(Cn3c(=O)oc4cccc([N+](=O)[O-])c43)c2)nc1 |
| InChI | InChI=1S/C23H23N5O5/c1-26(2)10-5-11-32-18-13-24-22(25-14-18)17-7-3-6-16(12-17)15-27-21-19(28(30)31)8-4-9-20(21)33-23(27)29/h3-4,6-9,12-14H,5,10-11,15H2,1-2H3 |
| InChIKey | YJFMCRDZCDUWAF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 116.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|