C24H24N4O5 — CID 58486018
3-[[3-[6-[3-(dimethylamino)propoxy]pyridazin-3-yl]phenyl]methyl]-2-oxo-1,3-benzoxazole-5-carboxylic acid (PubChem CID 58486018) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 3-[[3-[6-[3-(dimethylamino)propoxy]pyridazin-3-yl]phenyl]methyl]-2-oxo-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 3-[[3-[6-[3-(dimethylamino)propoxy]pyridazin-3-yl]phenyl]methyl]-2-oxo-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58486018 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-[[3-[6-[3-(dimethylamino)propoxy]pyridazin-3-yl]phenyl]methyl]-2-oxo-1,3-benzoxazole-5-carboxylic acid |
| SMILES | CN(C)CCCOc1ccc(-c2cccc(Cn3c(=O)oc4ccc(C(=O)O)cc43)c2)nn1 |
| InChI | InChI=1S/C24H24N4O5/c1-27(2)11-4-12-32-22-10-8-19(25-26-22)17-6-3-5-16(13-17)15-28-20-14-18(23(29)30)7-9-21(20)33-24(28)31/h3,5-10,13-14H,4,11-12,15H2,1-2H3,(H,29,30) |
| InChIKey | USHNLJHFVPIYMZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|