C23H24IN5O5-2 — CID 163757384
3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-[hydroxy(oxido)amino]iodanuidyl-1,3-benzoxazol-2-one (PubChem CID 163757384) has the molecular formula C23H24IN5O5-2 and a molecular weight of 577.38 g/mol. Its IUPAC name is 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-[hydroxy(oxido)amino]iodanuidyl-1,3-benzoxazol-2-one.
| Compound Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-[hydroxy(oxido)amino]iodanuidyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 163757384 |
| Molecular Formula | C23H24IN5O5-2 |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-[hydroxy(oxido)amino]iodanuidyl-1,3-benzoxazol-2-one |
| SMILES | CN(C)CCCOc1cnc(-c2cccc(Cn3c(=O)oc4ccc([I-]N([O-])O)cc43)c2)nc1 |
| InChI | InChI=1S/C23H24IN5O5/c1-27(2)9-4-10-33-19-13-25-22(26-14-19)17-6-3-5-16(11-17)15-28-20-12-18(24-29(31)32)7-8-21(20)34-23(28)30/h3,5-8,11-14,31H,4,9-10,15H2,1-2H3/q-2 |
| InChIKey | XAQLFKBOXWGXDD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|