C24H23F3N4O2S — CID 46846628
3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one (PubChem CID 46846628) has the molecular formula C24H23F3N4O2S and a molecular weight of 488.54 g/mol. Its IUPAC name is 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one.
| Compound Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 46846628 |
| Molecular Formula | C24H23F3N4O2S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one |
| SMILES | CN(C)CCCOc1cnc(-c2cccc(Cn3c(=O)sc4ccc(C(F)(F)F)cc43)c2)nc1 |
| InChI | InChI=1S/C24H23F3N4O2S/c1-30(2)9-4-10-33-19-13-28-22(29-14-19)17-6-3-5-16(11-17)15-31-20-12-18(24(25,26)27)7-8-21(20)34-23(31)32/h3,5-8,11-14H,4,9-10,15H2,1-2H3 |
| InChIKey | RTJHIWRBKAFNKS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|