C22H28N6O2 — CID 130351658
2-N-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-6-methoxypyridine-2,3-diamine (PubChem CID 130351658) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-N-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-6-methoxypyridine-2,3-diamine.
| Compound Name | 2-N-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-6-methoxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 130351658 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-N-[[3-[5-[3-(dimethylamino)propoxy]pyrimidin-2-yl]phenyl]methyl]-6-methoxypyridine-2,3-diamine |
| SMILES | COc1ccc(N)c(NCc2cccc(-c3ncc(OCCCN(C)C)cn3)c2)n1 |
| InChI | InChI=1S/C22H28N6O2/c1-28(2)10-5-11-30-18-14-25-21(26-15-18)17-7-4-6-16(12-17)13-24-22-19(23)8-9-20(27-22)29-3/h4,6-9,12,14-15H,5,10-11,13,23H2,1-3H3,(H,24,27) |
| InChIKey | LPLCZFIDWSVCQC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|